C8H14O8 — CID 21054039
[(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-4-methoxyoxan-3-yl] acetate (PubChem CID 21054039) has the molecular formula C8H14O8 and a molecular weight of 238.19 g/mol. Its IUPAC name is [(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-4-methoxyoxan-3-yl] acetate.
| Compound Name | [(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-4-methoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 21054039 |
| Molecular Formula | C8H14O8 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | [(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-4-methoxyoxan-3-yl] acetate |
| SMILES | CO[C@]1(O)[C@@H](O)[C@@H](O)OC[C@]1(O)OC(C)=O |
| InChI | InChI=1S/C8H14O8/c1-4(9)16-7(12)3-15-6(11)5(10)8(7,13)14-2/h5-6,10-13H,3H2,1-2H3/t5-,6-,7-,8+/m0/s1 |
| InChIKey | ZDANQADPBXXRMH-DKXJUACHSA-N |
| XLogP | -2.72 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|