C8H14O8 — CID 21054043
[(2R,3R,4R)-1,2,3,4-tetrahydroxy-3-methoxy-5-oxopentan-2-yl] acetate (PubChem CID 21054043) has the molecular formula C8H14O8 and a molecular weight of 238.19 g/mol. Its IUPAC name is [(2R,3R,4R)-1,2,3,4-tetrahydroxy-3-methoxy-5-oxopentan-2-yl] acetate.
| Compound Name | [(2R,3R,4R)-1,2,3,4-tetrahydroxy-3-methoxy-5-oxopentan-2-yl] acetate |
|---|---|
| PubChem CID | 21054043 |
| Molecular Formula | C8H14O8 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | [(2R,3R,4R)-1,2,3,4-tetrahydroxy-3-methoxy-5-oxopentan-2-yl] acetate |
| SMILES | CO[C@](O)([C@H](O)C=O)[C@@](O)(CO)OC(C)=O |
| InChI | InChI=1S/C8H14O8/c1-5(11)16-7(13,4-10)8(14,15-2)6(12)3-9/h3,6,10,12-14H,4H2,1-2H3/t6-,7-,8-/m1/s1 |
| InChIKey | ITYCZNQHKCVEKQ-BWZBUEFSSA-N |
| XLogP | -2.87 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|