About 1-(oxan-4-yl)ethanamine
1-(oxan-4-yl)ethanamine (PubChem CID 21054631) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is 1-(oxan-4-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(oxan-4-yl)ethanamine |
| PubChem CID | 21054631 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 1-(oxan-4-yl)ethanamine |
| SMILES | CC(N)C1CCOCC1 |
| InChI | InChI=1S/C7H15NO/c1-6(8)7-2-4-9-5-3-7/h6-7H,2-5,8H2,1H3 |
| InChIKey | WMPAKQDIADKRAQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(oxan-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-4-yl)ethanamine?
The IUPAC name of 1-(oxan-4-yl)ethanamine (CID 21054631) is 1-(oxan-4-yl)ethanamine.
What is the SMILES notation for 1-(oxan-4-yl)ethanamine?
The canonical SMILES for 1-(oxan-4-yl)ethanamine is CC(N)C1CCOCC1.
What is the InChIKey of 1-(oxan-4-yl)ethanamine?
The InChIKey is WMPAKQDIADKRAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO/c1-6(8)7-2-4-9-5-3-7/h6-7H,2-5,8H2,1H3.
What are the key properties of 1-(oxan-4-yl)ethanamine?
1-(oxan-4-yl)ethanamine has a molecular weight of 129.20 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-4-yl)ethanamine is sourced from PubChem (CID 21054631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).