C19H25F3N2O5S — CID 21054707
tert-butyl 6-(trifluoromethylsulfonyloxy)spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-carboxylate (PubChem CID 21054707) has the molecular formula C19H25F3N2O5S and a molecular weight of 450.48 g/mol. Its IUPAC name is tert-butyl 6-(trifluoromethylsulfonyloxy)spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 6-(trifluoromethylsulfonyloxy)spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 21054707 |
| Molecular Formula | C19H25F3N2O5S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | tert-butyl 6-(trifluoromethylsulfonyloxy)spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)NCCc1cc(OS(=O)(=O)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C19H25F3N2O5S/c1-17(2,3)28-16(25)24-10-7-18(8-11-24)15-5-4-14(12-13(15)6-9-23-18)29-30(26,27)19(20,21)22/h4-5,12,23H,6-11H2,1-3H3 |
| InChIKey | SNTBGZAQJGDFNC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|