C7H14N4 — CID 21054922
2,5-di(propan-2-yl)tetrazole (PubChem CID 21054922) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is 2,5-di(propan-2-yl)tetrazole.
| Compound Name | 2,5-di(propan-2-yl)tetrazole |
|---|---|
| PubChem CID | 21054922 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 2,5-di(propan-2-yl)tetrazole |
| SMILES | CC(C)c1nnn(C(C)C)n1 |
| InChI | InChI=1S/C7H14N4/c1-5(2)7-8-10-11(9-7)6(3)4/h5-6H,1-4H3 |
| InChIKey | KHXNHNNUTPPNHR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |