C23H35N2O+ — CID 2105503
dicyclohexyl-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]azanium (PubChem CID 2105503) has the molecular formula C23H35N2O+ and a molecular weight of 355.55 g/mol. Its IUPAC name is dicyclohexyl-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]azanium.
| Compound Name | dicyclohexyl-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 2105503 |
| Molecular Formula | C23H35N2O+ |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | dicyclohexyl-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]azanium |
| SMILES | O=C(C[NH+](C1CCCCC1)C1CCCCC1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H34N2O/c26-23(24-16-15-19-9-7-8-10-20(19)17-24)18-25(21-11-3-1-4-12-21)22-13-5-2-6-14-22/h7-10,21-22H,1-6,11-18H2/p+1 |
| InChIKey | YJGMGNKJGNMJOH-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |