About 1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one
1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one (PubChem CID 21055092) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one.
Molecular Properties
| Compound Name | 1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one |
| PubChem CID | 21055092 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one |
| SMILES | [CH2-][NH+]1C(=O)C=C(C)N1C |
| InChI | InChI=1S/C6H10N2O/c1-5-4-6(9)8(3)7(5)2/h4,8H,3H2,1-2H3 |
| InChIKey | SNPXUUPOHHZJDT-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one?
The IUPAC name of 1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one (CID 21055092) is 1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one.
What is the SMILES notation for 1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one?
The canonical SMILES for 1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one is [CH2-][NH+]1C(=O)C=C(C)N1C.
What is the InChIKey of 1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one?
The InChIKey is SNPXUUPOHHZJDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-5-4-6(9)8(3)7(5)2/h4,8H,3H2,1-2H3.
What are the key properties of 1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one?
1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one has a molecular weight of 126.16 g/mol, XLogP of -1.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methanidyl-2,3-dimethyl-1H-pyrazol-1-ium-5-one is sourced from PubChem (CID 21055092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).