C21H27NO3S2 — CID 21055348
(3R)-N-[(2S)-3-[2-(methoxymethoxy)phenyl]sulfanyl-2-methylpropyl]-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine (PubChem CID 21055348) has the molecular formula C21H27NO3S2 and a molecular weight of 405.59 g/mol. Its IUPAC name is (3R)-N-[(2S)-3-[2-(methoxymethoxy)phenyl]sulfanyl-2-methylpropyl]-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine.
| Compound Name | (3R)-N-[(2S)-3-[2-(methoxymethoxy)phenyl]sulfanyl-2-methylpropyl]-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine |
|---|---|
| PubChem CID | 21055348 |
| Molecular Formula | C21H27NO3S2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (3R)-N-[(2S)-3-[2-(methoxymethoxy)phenyl]sulfanyl-2-methylpropyl]-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine |
| SMILES | COCOc1ccccc1SC[C@@H](C)CN[C@@H]1COc2ccccc2SC1 |
| InChI | InChI=1S/C21H27NO3S2/c1-16(13-26-21-10-6-4-8-19(21)25-15-23-2)11-22-17-12-24-18-7-3-5-9-20(18)27-14-17/h3-10,16-17,22H,11-15H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | CYVTVFDSDBPWQQ-DLBZAZTESA-N |
| XLogP | 4.54 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|