C28H37NO4S — CID 21055389
(3Z,9Z)-11-hydroxy-15-methyl-13-methylidene-7-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one (PubChem CID 21055389) has the molecular formula C28H37NO4S and a molecular weight of 483.67 g/mol. Its IUPAC name is (3Z,9Z)-11-hydroxy-15-methyl-13-methylidene-7-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one.
| Compound Name | (3Z,9Z)-11-hydroxy-15-methyl-13-methylidene-7-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
|---|---|
| PubChem CID | 21055389 |
| Molecular Formula | C28H37NO4S |
| Molecular Weight | 483.67 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | (3Z,9Z)-11-hydroxy-15-methyl-13-methylidene-7-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
| SMILES | C=C1CC(O)/C=C\CC(/C(C)=C/c2csc(C)n2)OC(=O)/C=C\CC2C=CCC(CC(C)C1)O2 |
| InChI | InChI=1S/C28H37NO4S/c1-19-14-20(2)16-26-11-6-9-25(32-26)10-7-13-28(31)33-27(12-5-8-24(30)15-19)21(3)17-23-18-34-22(4)29-23/h5-9,13,17-18,20,24-27,30H,1,10-12,14-16H2,2-4H3/b8-5-,13-7-,21-17+ |
| InChIKey | BOXKESRIFGCETB-OWPSVXQJSA-N |
| XLogP | 6.11 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|