C31H52O10 — CID 21055589
1-O,5-O-dibutyl 3-O,7-O-dimethyl 3-(3-butoxy-2-methyl-3-oxopropyl)-1-methyloct-7-ene-1,3,5,7-tetracarboxylate (PubChem CID 21055589) has the molecular formula C31H52O10 and a molecular weight of 584.75 g/mol. Its IUPAC name is 1-O,5-O-dibutyl 3-O,7-O-dimethyl 3-(3-butoxy-2-methyl-3-oxopropyl)-1-methyloct-7-ene-1,3,5,7-tetracarboxylate.
| Compound Name | 1-O,5-O-dibutyl 3-O,7-O-dimethyl 3-(3-butoxy-2-methyl-3-oxopropyl)-1-methyloct-7-ene-1,3,5,7-tetracarboxylate |
|---|---|
| PubChem CID | 21055589 |
| Molecular Formula | C31H52O10 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.36 |
| IUPAC Name | 1-O,5-O-dibutyl 3-O,7-O-dimethyl 3-(3-butoxy-2-methyl-3-oxopropyl)-1-methyloct-7-ene-1,3,5,7-tetracarboxylate |
| SMILES | C=C(CC(CC(CC(C)C(=O)OCCCC)(CC(C)C(=O)OCCCC)C(=O)OC)C(=O)OCCCC)C(=O)OC |
| InChI | InChI=1S/C31H52O10/c1-9-12-15-39-27(33)23(5)19-31(30(36)38-8,20-24(6)28(34)40-16-13-10-2)21-25(18-22(4)26(32)37-7)29(35)41-17-14-11-3/h23-25H,4,9-21H2,1-3,5-8H3 |
| InChIKey | ZPDDBAHACBKZPU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|