C20H17N5S3 — CID 2105612
4-[[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanenitrile (PubChem CID 2105612) has the molecular formula C20H17N5S3 and a molecular weight of 423.59 g/mol. Its IUPAC name is 4-[[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanenitrile.
| Compound Name | 4-[[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanenitrile |
|---|---|
| PubChem CID | 2105612 |
| Molecular Formula | C20H17N5S3 |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 4-[[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanenitrile |
| SMILES | N#CCCCSc1nnc(CSc2nc3ccccc3s2)n1-c1ccccc1 |
| InChI | InChI=1S/C20H17N5S3/c21-12-6-7-13-26-19-24-23-18(25(19)15-8-2-1-3-9-15)14-27-20-22-16-10-4-5-11-17(16)28-20/h1-5,8-11H,6-7,13-14H2 |
| InChIKey | MSEDEKSHLGGJQY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|