C23H29N3O6 — CID 21056369
(2S)-N-[N'-(3,4-dihydroxyphenyl)carbamimidoyl]-6-hydroxy-N-(2-hydroxyethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide (PubChem CID 21056369) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is (2S)-N-[N'-(3,4-dihydroxyphenyl)carbamimidoyl]-6-hydroxy-N-(2-hydroxyethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide.
| Compound Name | (2S)-N-[N'-(3,4-dihydroxyphenyl)carbamimidoyl]-6-hydroxy-N-(2-hydroxyethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide |
|---|---|
| PubChem CID | 21056369 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (2S)-N-[N'-(3,4-dihydroxyphenyl)carbamimidoyl]-6-hydroxy-N-(2-hydroxyethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide |
| SMILES | Cc1c(C)c2c(c(C)c1O)CC[C@@](C)(C(=O)N(CCO)/C(N)=N/c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C23H29N3O6/c1-12-13(2)20-16(14(3)19(12)30)7-8-23(4,32-20)21(31)26(9-10-27)22(24)25-15-5-6-17(28)18(29)11-15/h5-6,11,27-30H,7-10H2,1-4H3,(H2,24,25)/t23-/m0/s1 |
| InChIKey | GJSQDYCTGTXZPH-QHCPKHFHSA-N |
| XLogP | 2.28 |
| TPSA | 148.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|