C15H10ClN3O3 — CID 2105651
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-chloropyridine-3-carboxylate (PubChem CID 2105651) has the molecular formula C15H10ClN3O3 and a molecular weight of 315.72 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-chloropyridine-3-carboxylate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2105651 |
| Molecular Formula | C15H10ClN3O3 |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-chloropyridine-3-carboxylate |
| SMILES | O=C(OCc1nnc(-c2ccccc2)o1)c1cccnc1Cl |
| InChI | InChI=1S/C15H10ClN3O3/c16-13-11(7-4-8-17-13)15(20)21-9-12-18-19-14(22-12)10-5-2-1-3-6-10/h1-8H,9H2 |
| InChIKey | MJYFVVXEEBEVJK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|