C19H18F5N3 — CID 21056591
(4aS,9bR)-N-(2,4-difluorophenyl)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-amine (PubChem CID 21056591) has the molecular formula C19H18F5N3 and a molecular weight of 383.36 g/mol. Its IUPAC name is (4aS,9bR)-N-(2,4-difluorophenyl)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-amine.
| Compound Name | (4aS,9bR)-N-(2,4-difluorophenyl)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-amine |
|---|---|
| PubChem CID | 21056591 |
| Molecular Formula | C19H18F5N3 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | (4aS,9bR)-N-(2,4-difluorophenyl)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-amine |
| SMILES | CN1c2c(cc(Nc3ccc(F)cc3F)cc2C(F)(F)F)[C@@H]2CNCC[C@@H]21 |
| InChI | InChI=1S/C19H18F5N3/c1-27-17-4-5-25-9-13(17)12-7-11(8-14(18(12)27)19(22,23)24)26-16-3-2-10(20)6-15(16)21/h2-3,6-8,13,17,25-26H,4-5,9H2,1H3/t13-,17-/m0/s1 |
| InChIKey | UWGRXVIFMWQIMO-GUYCJALGSA-N |
| XLogP | 4.62 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |