About 1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+)
1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+) (PubChem CID 21056981) has the molecular formula C11H14OV
and a molecular weight of 213.18 g/mol. Its IUPAC name is 1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+).
Molecular Properties
| Compound Name | 1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+) |
| PubChem CID | 21056981 |
| Molecular Formula | C11H14OV |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+) |
| SMILES | [CH2-]Oc1[c-]cc(C(C)(C)C)cc1.[V+2] |
| InChI | InChI=1S/C11H14O.V/c1-11(2,3)9-5-7-10(12-4)8-6-9;/h5-7H,4H2,1-3H3;/q-2;+2 |
| InChIKey | DCHICJLWKRWVKD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+)?
The IUPAC name of 1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+) (CID 21056981) is 1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+).
What is the SMILES notation for 1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+)?
The canonical SMILES for 1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+) is [CH2-]Oc1[c-]cc(C(C)(C)C)cc1.[V+2].
What is the InChIKey of 1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+)?
The InChIKey is DCHICJLWKRWVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O.V/c1-11(2,3)9-5-7-10(12-4)8-6-9;/h5-7H,4H2,1-3H3;/q-2;+2.
What are the key properties of 1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+)?
1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+) has a molecular weight of 213.18 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-methanidyloxybenzene-5-ide;vanadium(2+) is sourced from PubChem (CID 21056981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).