C20H18N4O2S3 — CID 21057059
4-(1-benzylbenzimidazol-5-yl)sulfonyl-5-methylsulfanylthiophene-2-carboximidamide (PubChem CID 21057059) has the molecular formula C20H18N4O2S3 and a molecular weight of 442.59 g/mol. Its IUPAC name is 4-(1-benzylbenzimidazol-5-yl)sulfonyl-5-methylsulfanylthiophene-2-carboximidamide.
| Compound Name | 4-(1-benzylbenzimidazol-5-yl)sulfonyl-5-methylsulfanylthiophene-2-carboximidamide |
|---|---|
| PubChem CID | 21057059 |
| Molecular Formula | C20H18N4O2S3 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 4-(1-benzylbenzimidazol-5-yl)sulfonyl-5-methylsulfanylthiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(S(=O)(=O)c2ccc3c(c2)ncn3Cc2ccccc2)c(SC)s1 |
| InChI | InChI=1S/C20H18N4O2S3/c1-27-20-18(10-17(28-20)19(21)22)29(25,26)14-7-8-16-15(9-14)23-12-24(16)11-13-5-3-2-4-6-13/h2-10,12H,11H2,1H3,(H3,21,22) |
| InChIKey | ZEZFPCHSCVGNME-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|