C25H27FO2S — CID 21057273
(7R,8S,9S,11S,13S,14R,16S)-11-fluoro-3,16-dihydroxy-13-methyl-7-phenyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-15-carbothialdehyde (PubChem CID 21057273) has the molecular formula C25H27FO2S and a molecular weight of 410.55 g/mol. Its IUPAC name is (7R,8S,9S,11S,13S,14R,16S)-11-fluoro-3,16-dihydroxy-13-methyl-7-phenyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-15-carbothialdehyde.
| Compound Name | (7R,8S,9S,11S,13S,14R,16S)-11-fluoro-3,16-dihydroxy-13-methyl-7-phenyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-15-carbothialdehyde |
|---|---|
| PubChem CID | 21057273 |
| Molecular Formula | C25H27FO2S |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (7R,8S,9S,11S,13S,14R,16S)-11-fluoro-3,16-dihydroxy-13-methyl-7-phenyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-15-carbothialdehyde |
| SMILES | C[C@@]12C[C@H](O)C(C=S)[C@H]1[C@H]1[C@@H](c3ccc(O)cc3C[C@H]1c1ccccc1)[C@@H](F)C2 |
| InChI | InChI=1S/C25H27FO2S/c1-25-11-20(26)22-17-8-7-16(27)9-15(17)10-18(14-5-3-2-4-6-14)23(22)24(25)19(13-29)21(28)12-25/h2-9,13,18-24,27-28H,10-12H2,1H3/t18-,19?,20-,21-,22-,23+,24-,25+/m0/s1 |
| InChIKey | NEVSMVQVZFFBHW-YKHHZEPMSA-N |
| XLogP | 5.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|