C19H23F5O3 — CID 21057409
2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]-5-ethyl-1,3-dioxane (PubChem CID 21057409) has the molecular formula C19H23F5O3 and a molecular weight of 394.38 g/mol. Its IUPAC name is 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]-5-ethyl-1,3-dioxane.
| Compound Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]-5-ethyl-1,3-dioxane |
|---|---|
| PubChem CID | 21057409 |
| Molecular Formula | C19H23F5O3 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]-5-ethyl-1,3-dioxane |
| SMILES | CCC1COC(C2CCC(C(F)(F)Oc3cc(F)c(F)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C19H23F5O3/c1-2-11-9-25-18(26-10-11)12-3-5-13(6-4-12)19(23,24)27-14-7-15(20)17(22)16(21)8-14/h7-8,11-13,18H,2-6,9-10H2,1H3 |
| InChIKey | CQPIZARIKDQLNR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|