C22H29F5O3 — CID 21057411
2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]-5-pentyl-1,3-dioxane (PubChem CID 21057411) has the molecular formula C22H29F5O3 and a molecular weight of 436.46 g/mol. Its IUPAC name is 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 21057411 |
| Molecular Formula | C22H29F5O3 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(C2CCC(C(F)(F)Oc3cc(F)c(F)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C22H29F5O3/c1-2-3-4-5-14-12-28-21(29-13-14)15-6-8-16(9-7-15)22(26,27)30-17-10-18(23)20(25)19(24)11-17/h10-11,14-16,21H,2-9,12-13H2,1H3 |
| InChIKey | UYAQABLFCDGVRI-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|