C18H20Cl2N2O3S — CID 21057627
1-[[2,6-dichloro-3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]phenyl]methyl]-3-propan-2-ylthiourea (PubChem CID 21057627) has the molecular formula C18H20Cl2N2O3S and a molecular weight of 415.34 g/mol. Its IUPAC name is 1-[[2,6-dichloro-3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]phenyl]methyl]-3-propan-2-ylthiourea.
| Compound Name | 1-[[2,6-dichloro-3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]phenyl]methyl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 21057627 |
| Molecular Formula | C18H20Cl2N2O3S |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 1-[[2,6-dichloro-3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]phenyl]methyl]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)NCc1c(Cl)ccc(C(O)=C2C(=O)CCCC2=O)c1Cl |
| InChI | InChI=1S/C18H20Cl2N2O3S/c1-9(2)22-18(26)21-8-11-12(19)7-6-10(16(11)20)17(25)15-13(23)4-3-5-14(15)24/h6-7,9,25H,3-5,8H2,1-2H3,(H2,21,22,26) |
| InChIKey | CRWHZVIEKSMXFD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|