C9H13N3OS — CID 21057909
methyl N-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)methanimidate (PubChem CID 21057909) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is methyl N-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)methanimidate.
| Compound Name | methyl N-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)methanimidate |
|---|---|
| PubChem CID | 21057909 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | methyl N-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)methanimidate |
| SMILES | CO/C=N/C1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C9H13N3OS/c1-13-5-11-6-2-3-7-8(4-6)14-9(10)12-7/h5-6H,2-4H2,1H3,(H2,10,12)/b11-5+ |
| InChIKey | SNGJWUQDCRNPEE-VZUCSPMQSA-N |
| XLogP | 1.26 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|