About (3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one
(3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one (PubChem CID 21058764) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is (3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one.
Molecular Properties
| Compound Name | (3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one |
| PubChem CID | 21058764 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one |
| SMILES | C/C=C1\CC2CC(C1=O)C2(C)C |
| InChI | InChI=1S/C11H16O/c1-4-7-5-8-6-9(10(7)12)11(8,2)3/h4,8-9H,5-6H2,1-3H3/b7-4+ |
| InChIKey | UQNNABRNBGEISM-QPJJXVBHSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one?
The IUPAC name of (3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one (CID 21058764) is (3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one.
What is the SMILES notation for (3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one?
The canonical SMILES for (3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one is C/C=C1\CC2CC(C1=O)C2(C)C.
What is the InChIKey of (3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one?
The InChIKey is UQNNABRNBGEISM-QPJJXVBHSA-N. The full InChI is InChI=1S/C11H16O/c1-4-7-5-8-6-9(10(7)12)11(8,2)3/h4,8-9H,5-6H2,1-3H3/b7-4+.
What are the key properties of (3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one?
(3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one has a molecular weight of 164.25 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-ethylidene-6,6-dimethylbicyclo[3.1.1]heptan-2-one is sourced from PubChem (CID 21058764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).