About N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide
N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide (PubChem CID 21059348) has the molecular formula C13H22N2O5
and a molecular weight of 286.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide |
| PubChem CID | 21059348 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide |
| SMILES | COCCNC(=O)CCC(=O)N(CC(C)=O)CC(C)=O |
| InChI | InChI=1S/C13H22N2O5/c1-10(16)8-15(9-11(2)17)13(19)5-4-12(18)14-6-7-20-3/h4-9H2,1-3H3,(H,14,18) |
| InChIKey | ZDYVGXWTPRLOFM-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide?
The IUPAC name of N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide (CID 21059348) is N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide.
What is the SMILES notation for N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide?
The canonical SMILES for N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide is COCCNC(=O)CCC(=O)N(CC(C)=O)CC(C)=O.
What is the InChIKey of N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide?
The InChIKey is ZDYVGXWTPRLOFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O5/c1-10(16)8-15(9-11(2)17)13(19)5-4-12(18)14-6-7-20-3/h4-9H2,1-3H3,(H,14,18).
What are the key properties of N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide?
N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide has a molecular weight of 286.33 g/mol, XLogP of -0.46, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-N',N'-bis(2-oxopropyl)butanediamide is sourced from PubChem (CID 21059348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).