C29H29FN3O14P3 — CID 21059506
[[[2-(3-fluorophenyl)-4-(2-oxo-4-phenylmethoxypyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-phenylphosphonamidic acid (PubChem CID 21059506) has the molecular formula C29H29FN3O14P3 and a molecular weight of 755.48 g/mol. Its IUPAC name is [[[2-(3-fluorophenyl)-4-(2-oxo-4-phenylmethoxypyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-phenylphosphonamidic acid.
| Compound Name | [[[2-(3-fluorophenyl)-4-(2-oxo-4-phenylmethoxypyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-phenylphosphonamidic acid |
|---|---|
| PubChem CID | 21059506 |
| Molecular Formula | C29H29FN3O14P3 |
| Molecular Weight | 755.48 g/mol |
| Exact Mass | 755.08 |
| IUPAC Name | [[[2-(3-fluorophenyl)-4-(2-oxo-4-phenylmethoxypyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-phenylphosphonamidic acid |
| SMILES | O=c1nc(OCc2ccccc2)ccn1C1OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)Nc2ccccc2)C2OC(c3cccc(F)c3)OC21 |
| InChI | InChI=1S/C29H29FN3O14P3/c30-21-11-7-10-20(16-21)28-44-25-23(18-42-49(37,38)47-50(39,40)46-48(35,36)32-22-12-5-2-6-13-22)43-27(26(25)45-28)33-15-14-24(31-29(33)34)41-17-19-8-3-1-4-9-19/h1-16,23,25-28H,17-18H2,(H,37,38)(H,39,40)(H2,32,35,36) |
| InChIKey | GETWDIKKMAPVIG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 223.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|