C13H23NO2 — CID 21060133
(E)-1-(2,6-dimethylmorpholin-4-yl)-4,4-dimethylpent-2-en-1-one (PubChem CID 21060133) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (E)-1-(2,6-dimethylmorpholin-4-yl)-4,4-dimethylpent-2-en-1-one.
| Compound Name | (E)-1-(2,6-dimethylmorpholin-4-yl)-4,4-dimethylpent-2-en-1-one |
|---|---|
| PubChem CID | 21060133 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (E)-1-(2,6-dimethylmorpholin-4-yl)-4,4-dimethylpent-2-en-1-one |
| SMILES | CC1CN(C(=O)/C=C/C(C)(C)C)CC(C)O1 |
| InChI | InChI=1S/C13H23NO2/c1-10-8-14(9-11(2)16-10)12(15)6-7-13(3,4)5/h6-7,10-11H,8-9H2,1-5H3/b7-6+ |
| InChIKey | CDFWDDYCFKUFAC-VOTSOKGWSA-N |
| XLogP | 2.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|