About ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate
ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 21060425) has the molecular formula C16H21NO4
and a molecular weight of 291.35 g/mol. Its IUPAC name is ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate |
| PubChem CID | 21060425 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NOC(c2cccc(OC(C)(C)C)c2)C1 |
| InChI | InChI=1S/C16H21NO4/c1-5-19-15(18)13-10-14(21-17-13)11-7-6-8-12(9-11)20-16(2,3)4/h6-9,14H,5,10H2,1-4H3 |
| InChIKey | IZUBGASWHQQZKP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate?
The IUPAC name of ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate (CID 21060425) is ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate.
What is the SMILES notation for ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate?
The canonical SMILES for ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate is CCOC(=O)C1=NOC(c2cccc(OC(C)(C)C)c2)C1.
What is the InChIKey of ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate?
The InChIKey is IZUBGASWHQQZKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO4/c1-5-19-15(18)13-10-14(21-17-13)11-7-6-8-12(9-11)20-16(2,3)4/h6-9,14H,5,10H2,1-4H3.
What are the key properties of ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate?
ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate has a molecular weight of 291.35 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[3-[(2-methylpropan-2-yl)oxy]phenyl]-4,5-dihydro-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 21060425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).