C29H31N3O4S — CID 21060909
tert-butyl (5S)-2-amino-5-[(1,3-dioxoisoindol-2-yl)methyl]-6-[(1S)-1-phenylethyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (PubChem CID 21060909) has the molecular formula C29H31N3O4S and a molecular weight of 517.65 g/mol. Its IUPAC name is tert-butyl (5S)-2-amino-5-[(1,3-dioxoisoindol-2-yl)methyl]-6-[(1S)-1-phenylethyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | tert-butyl (5S)-2-amino-5-[(1,3-dioxoisoindol-2-yl)methyl]-6-[(1S)-1-phenylethyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 21060909 |
| Molecular Formula | C29H31N3O4S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | tert-butyl (5S)-2-amino-5-[(1,3-dioxoisoindol-2-yl)methyl]-6-[(1S)-1-phenylethyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| SMILES | C[C@@H](c1ccccc1)N1Cc2sc(N)c(C(=O)OC(C)(C)C)c2C[C@H]1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H31N3O4S/c1-17(18-10-6-5-7-11-18)31-16-23-22(24(25(30)37-23)28(35)36-29(2,3)4)14-19(31)15-32-26(33)20-12-8-9-13-21(20)27(32)34/h5-13,17,19H,14-16,30H2,1-4H3/t17-,19-/m0/s1 |
| InChIKey | SPWZXPLPYMDECH-HKUYNNGSSA-N |
| XLogP | 5.07 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|