C16H31NS — CID 21060990
3-butyl-5,6-ditert-butyl-2,4-dihydro-1,3-thiazine (PubChem CID 21060990) has the molecular formula C16H31NS and a molecular weight of 269.50 g/mol. Its IUPAC name is 3-butyl-5,6-ditert-butyl-2,4-dihydro-1,3-thiazine.
| Compound Name | 3-butyl-5,6-ditert-butyl-2,4-dihydro-1,3-thiazine |
|---|---|
| PubChem CID | 21060990 |
| Molecular Formula | C16H31NS |
| Molecular Weight | 269.50 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | 3-butyl-5,6-ditert-butyl-2,4-dihydro-1,3-thiazine |
| SMILES | CCCCN1CSC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C16H31NS/c1-8-9-10-17-11-13(15(2,3)4)14(18-12-17)16(5,6)7/h8-12H2,1-7H3 |
| InChIKey | WAKSHLVOTWSCSY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |