C33H28F3N7O2S2 — CID 21061528
N-[(2Z)-2-[3-benzyl-2-[5-cyano-2-(ethylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]-3-methyl-1,3-benzothiazol-6-yl]-N-(3-cyanopropyl)-2,2,2-trifluoroacetamide (PubChem CID 21061528) has the molecular formula C33H28F3N7O2S2 and a molecular weight of 675.76 g/mol. Its IUPAC name is N-[(2Z)-2-[3-benzyl-2-[5-cyano-2-(ethylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]-3-methyl-1,3-benzothiazol-6-yl]-N-(3-cyanopropyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2Z)-2-[3-benzyl-2-[5-cyano-2-(ethylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]-3-methyl-1,3-benzothiazol-6-yl]-N-(3-cyanopropyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 21061528 |
| Molecular Formula | C33H28F3N7O2S2 |
| Molecular Weight | 675.76 g/mol |
| Exact Mass | 675.17 |
| IUPAC Name | N-[(2Z)-2-[3-benzyl-2-[5-cyano-2-(ethylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]-3-methyl-1,3-benzothiazol-6-yl]-N-(3-cyanopropyl)-2,2,2-trifluoroacetamide |
| SMILES | CCNc1ccc(C#N)cc1/N=C1\S/C(=C2\Sc3cc(N(CCCC#N)C(=O)C(F)(F)F)ccc3N2C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C33H28F3N7O2S2/c1-3-39-24-13-11-22(19-38)17-25(24)40-32-43(20-21-9-5-4-6-10-21)29(44)28(47-32)30-41(2)26-14-12-23(18-27(26)46-30)42(16-8-7-15-37)31(45)33(34,35)36/h4-6,9-14,17-18,39H,3,7-8,16,20H2,1-2H3/b30-28-,40-32- |
| InChIKey | SGSOJABVZJMFOV-LXMSSXGXSA-N |
| XLogP | 7.36 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.76 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|