About 4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide
4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 21061631) has the molecular formula C10H23N3O2S
and a molecular weight of 249.38 g/mol. Its IUPAC name is 4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide |
| PubChem CID | 21061631 |
| Molecular Formula | C10H23N3O2S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C10H23N3O2S/c1-10(2,3)12-6-8-13(9-7-12)16(14,15)11(4)5/h6-9H2,1-5H3 |
| InChIKey | JAEXJWQXGYYGQR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide?
The IUPAC name of 4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide (CID 21061631) is 4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide.
What is the SMILES notation for 4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide?
The canonical SMILES for 4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide is CN(C)S(=O)(=O)N1CCN(C(C)(C)C)CC1.
What is the InChIKey of 4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide?
The InChIKey is JAEXJWQXGYYGQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3O2S/c1-10(2,3)12-6-8-13(9-7-12)16(14,15)11(4)5/h6-9H2,1-5H3.
What are the key properties of 4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide?
4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide has a molecular weight of 249.38 g/mol, XLogP of 0.21, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N,N-dimethylpiperazine-1-sulfonamide is sourced from PubChem (CID 21061631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).