About 5,6-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine
5,6-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine (PubChem CID 21061691) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 5,6-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine.
Analyze 5,6-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine?
The IUPAC name of 5,6-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine (CID 21061691) is 5,6-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine.
What is the SMILES notation for 5,6-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine?
The canonical SMILES for 5,6-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine is CC1CCc2nnnn2C1C.
What is the InChIKey of 5,6-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine?
The InChIKey is KIAPJZYGZBPQKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-5-3-4-7-8-9-10-11(7)6(5)2/h5-6H,3-4H2,1-2H3.
What are the key properties of 5,6-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine?
5,6-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine has a molecular weight of 152.20 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine is sourced from PubChem (CID 21061691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).