About 6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine
6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine (PubChem CID 21061708) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine.
Analyze 6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine?
The IUPAC name of 6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine (CID 21061708) is 6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine.
What is the SMILES notation for 6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine?
The canonical SMILES for 6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine is CC1Cc2nnnn2CC1C.
What is the InChIKey of 6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine?
The InChIKey is CQLGOFBCHYBYIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-5-3-7-8-9-10-11(7)4-6(5)2/h5-6H,3-4H2,1-2H3.
What are the key properties of 6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine?
6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine has a molecular weight of 152.20 g/mol, XLogP of 0.50, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine is sourced from PubChem (CID 21061708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).