C20H34O5Si — CID 21061833
5-[tert-butyl(dimethyl)silyl]oxy-7-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)hept-2-ynoic acid (PubChem CID 21061833) has the molecular formula C20H34O5Si and a molecular weight of 382.57 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-7-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)hept-2-ynoic acid.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-7-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)hept-2-ynoic acid |
|---|---|
| PubChem CID | 21061833 |
| Molecular Formula | C20H34O5Si |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-7-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)hept-2-ynoic acid |
| SMILES | C=CC1OC(C)(C)OC1CCC(CC#CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O5Si/c1-9-16-17(24-20(5,6)23-16)14-13-15(11-10-12-18(21)22)25-26(7,8)19(2,3)4/h9,15-17H,1,11,13-14H2,2-8H3,(H,21,22) |
| InChIKey | JDQXYWHKDGCGBN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|