C18H20N2O7S2 — CID 2106206
methyl 4-[(4-morpholin-4-ylsulfonylphenyl)sulfonylamino]benzoate (PubChem CID 2106206) has the molecular formula C18H20N2O7S2 and a molecular weight of 440.50 g/mol. Its IUPAC name is methyl 4-[(4-morpholin-4-ylsulfonylphenyl)sulfonylamino]benzoate.
| Compound Name | methyl 4-[(4-morpholin-4-ylsulfonylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 2106206 |
| Molecular Formula | C18H20N2O7S2 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | methyl 4-[(4-morpholin-4-ylsulfonylphenyl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccc(NS(=O)(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C18H20N2O7S2/c1-26-18(21)14-2-4-15(5-3-14)19-28(22,23)16-6-8-17(9-7-16)29(24,25)20-10-12-27-13-11-20/h2-9,19H,10-13H2,1H3 |
| InChIKey | CTCROIFUWNYKKJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |