C10H7F9O — CID 21062400
1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-2-bicyclo[2.2.1]hept-5-enyl)propan-2-ol (PubChem CID 21062400) has the molecular formula C10H7F9O and a molecular weight of 314.15 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-2-bicyclo[2.2.1]hept-5-enyl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-2-bicyclo[2.2.1]hept-5-enyl)propan-2-ol |
|---|---|
| PubChem CID | 21062400 |
| Molecular Formula | C10H7F9O |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-2-bicyclo[2.2.1]hept-5-enyl)propan-2-ol |
| SMILES | OC(C(F)(F)F)(C(F)(F)F)C1(F)C2C=CC(C2)C1(F)F |
| InChI | InChI=1S/C10H7F9O/c11-6(4-1-2-5(3-4)7(6,12)13)8(20,9(14,15)16)10(17,18)19/h1-2,4-5,20H,3H2 |
| InChIKey | GYXXXTUKVJSADA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|