C9H4F12O2 — CID 21062411
1,2,2,3-tetrakis(trifluoromethyl)cyclopent-4-ene-1,3-diol (PubChem CID 21062411) has the molecular formula C9H4F12O2 and a molecular weight of 372.11 g/mol. Its IUPAC name is 1,2,2,3-tetrakis(trifluoromethyl)cyclopent-4-ene-1,3-diol.
| Compound Name | 1,2,2,3-tetrakis(trifluoromethyl)cyclopent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 21062411 |
| Molecular Formula | C9H4F12O2 |
| Molecular Weight | 372.11 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 1,2,2,3-tetrakis(trifluoromethyl)cyclopent-4-ene-1,3-diol |
| SMILES | OC1(C(F)(F)F)C=CC(O)(C(F)(F)F)C1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H4F12O2/c10-6(11,12)3(22)1-2-4(23,7(13,14)15)5(3,8(16,17)18)9(19,20)21/h1-2,22-23H |
| InChIKey | KVXCWJHVKUMFNN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.11 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|