C8H8F6O — CID 21062416
2-cyclopent-3-en-1-yl-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 21062416) has the molecular formula C8H8F6O and a molecular weight of 234.14 g/mol. Its IUPAC name is 2-cyclopent-3-en-1-yl-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-cyclopent-3-en-1-yl-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 21062416 |
| Molecular Formula | C8H8F6O |
| Molecular Weight | 234.14 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-cyclopent-3-en-1-yl-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(C1CC=CC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8F6O/c9-7(10,11)6(15,8(12,13)14)5-3-1-2-4-5/h1-2,5,15H,3-4H2 |
| InChIKey | JMOPLPPDTLGXOB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.14 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|