C9H10F6O — CID 21062417
2-(cyclopent-3-en-1-ylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 21062417) has the molecular formula C9H10F6O and a molecular weight of 248.17 g/mol. Its IUPAC name is 2-(cyclopent-3-en-1-ylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(cyclopent-3-en-1-ylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 21062417 |
| Molecular Formula | C9H10F6O |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-(cyclopent-3-en-1-ylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(CC1CC=CC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H10F6O/c10-8(11,12)7(16,9(13,14)15)5-6-3-1-2-4-6/h1-2,6,16H,3-5H2 |
| InChIKey | VMWBCPOKTHSVNR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|