C7H4F8O2 — CID 21062454
2,2-difluoro-1,3-bis(trifluoromethyl)cyclopent-4-ene-1,3-diol (PubChem CID 21062454) has the molecular formula C7H4F8O2 and a molecular weight of 272.09 g/mol. Its IUPAC name is 2,2-difluoro-1,3-bis(trifluoromethyl)cyclopent-4-ene-1,3-diol.
| Compound Name | 2,2-difluoro-1,3-bis(trifluoromethyl)cyclopent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 21062454 |
| Molecular Formula | C7H4F8O2 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 2,2-difluoro-1,3-bis(trifluoromethyl)cyclopent-4-ene-1,3-diol |
| SMILES | OC1(C(F)(F)F)C=CC(O)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C7H4F8O2/c8-5(9)3(16,6(10,11)12)1-2-4(5,17)7(13,14)15/h1-2,16-17H |
| InChIKey | VXCOOFNTDMHBCU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|