C16H7ClF6N2 — CID 21062562
2-[2,5-bis(trifluoromethyl)phenyl]-4-chloroquinazoline (PubChem CID 21062562) has the molecular formula C16H7ClF6N2 and a molecular weight of 376.69 g/mol. Its IUPAC name is 2-[2,5-bis(trifluoromethyl)phenyl]-4-chloroquinazoline.
| Compound Name | 2-[2,5-bis(trifluoromethyl)phenyl]-4-chloroquinazoline |
|---|---|
| PubChem CID | 21062562 |
| Molecular Formula | C16H7ClF6N2 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2-[2,5-bis(trifluoromethyl)phenyl]-4-chloroquinazoline |
| SMILES | FC(F)(F)c1ccc(C(F)(F)F)c(-c2nc(Cl)c3ccccc3n2)c1 |
| InChI | InChI=1S/C16H7ClF6N2/c17-13-9-3-1-2-4-12(9)24-14(25-13)10-7-8(15(18,19)20)5-6-11(10)16(21,22)23/h1-7H |
| InChIKey | NXTJZBSKVJYOFG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |