C25H27F3N4O2S — CID 21062656
1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-6-[3-(trifluoromethyl)phenyl]hexane-1,6-dione (PubChem CID 21062656) has the molecular formula C25H27F3N4O2S and a molecular weight of 504.58 g/mol. Its IUPAC name is 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-6-[3-(trifluoromethyl)phenyl]hexane-1,6-dione.
| Compound Name | 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-6-[3-(trifluoromethyl)phenyl]hexane-1,6-dione |
|---|---|
| PubChem CID | 21062656 |
| Molecular Formula | C25H27F3N4O2S |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-6-[3-(trifluoromethyl)phenyl]hexane-1,6-dione |
| SMILES | CCc1cc2c(N3CCN(C(=O)CCCCC(=O)c4cccc(C(F)(F)F)c4)CC3)ncnc2s1 |
| InChI | InChI=1S/C25H27F3N4O2S/c1-2-19-15-20-23(29-16-30-24(20)35-19)32-12-10-31(11-13-32)22(34)9-4-3-8-21(33)17-6-5-7-18(14-17)25(26,27)28/h5-7,14-16H,2-4,8-13H2,1H3 |
| InChIKey | YVDRMTNBSVZWBW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|