C24H29N7O2S — CID 21062737
4-(benzotriazol-1-yloxy)-1-[4-(2,6-diethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]butan-1-one (PubChem CID 21062737) has the molecular formula C24H29N7O2S and a molecular weight of 479.61 g/mol. Its IUPAC name is 4-(benzotriazol-1-yloxy)-1-[4-(2,6-diethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(benzotriazol-1-yloxy)-1-[4-(2,6-diethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 21062737 |
| Molecular Formula | C24H29N7O2S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 4-(benzotriazol-1-yloxy)-1-[4-(2,6-diethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]butan-1-one |
| SMILES | CCc1nc(N2CCN(C(=O)CCCOn3nnc4ccccc43)CC2)c2cc(CC)sc2n1 |
| InChI | InChI=1S/C24H29N7O2S/c1-3-17-16-18-23(25-21(4-2)26-24(18)34-17)30-13-11-29(12-14-30)22(32)10-7-15-33-31-20-9-6-5-8-19(20)27-28-31/h5-6,8-9,16H,3-4,7,10-15H2,1-2H3 |
| InChIKey | QBMVHVURYHXVLH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|