C22H22F3N7O2S — CID 21062741
4-(benzotriazol-1-yloxy)-1-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]butan-1-one (PubChem CID 21062741) has the molecular formula C22H22F3N7O2S and a molecular weight of 505.53 g/mol. Its IUPAC name is 4-(benzotriazol-1-yloxy)-1-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-(benzotriazol-1-yloxy)-1-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 21062741 |
| Molecular Formula | C22H22F3N7O2S |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 4-(benzotriazol-1-yloxy)-1-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCOn1nnc2ccccc21)N1CCN(c2ncnc3sc(CC(F)(F)F)cc23)CC1 |
| InChI | InChI=1S/C22H22F3N7O2S/c23-22(24,25)13-15-12-16-20(26-14-27-21(16)35-15)31-9-7-30(8-10-31)19(33)6-3-11-34-32-18-5-2-1-4-17(18)28-29-32/h1-2,4-5,12,14H,3,6-11,13H2 |
| InChIKey | KCRMVHSMUDGGGV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|