About 2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole
2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole (PubChem CID 21062900) has the molecular formula C19H22N2OS
and a molecular weight of 326.47 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 21062900 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole |
| SMILES | COc1ccc(CSC2=NCC(C(C)c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C19H22N2OS/c1-14(16-6-4-3-5-7-16)18-12-20-19(21-18)23-13-15-8-10-17(22-2)11-9-15/h3-11,14,18H,12-13H2,1-2H3,(H,20,21) |
| InChIKey | GMXMQSHDQSNZRF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole (CID 21062900) is 2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole is COc1ccc(CSC2=NCC(C(C)c3ccccc3)N2)cc1.
What is the InChIKey of 2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole?
The InChIKey is GMXMQSHDQSNZRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2OS/c1-14(16-6-4-3-5-7-16)18-12-20-19(21-18)23-13-15-8-10-17(22-2)11-9-15/h3-11,14,18H,12-13H2,1-2H3,(H,20,21).
What are the key properties of 2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole?
2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole has a molecular weight of 326.47 g/mol, XLogP of 4.06, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methoxyphenyl)methylsulfanyl]-5-(1-phenylethyl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 21062900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).