About ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate
ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate (PubChem CID 21062968) has the molecular formula C15H24N2O5
and a molecular weight of 312.37 g/mol. Its IUPAC name is ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate |
| PubChem CID | 21062968 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)Cn1nc(C(=O)OCC)cc1OCC(C)(C)C |
| InChI | InChI=1S/C15H24N2O5/c1-6-20-13(18)9-17-12(22-10-15(3,4)5)8-11(16-17)14(19)21-7-2/h8H,6-7,9-10H2,1-5H3 |
| InChIKey | YBCSVZRVTGRQFY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate?
The IUPAC name of ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate (CID 21062968) is ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate?
The canonical SMILES for ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate is CCOC(=O)Cn1nc(C(=O)OCC)cc1OCC(C)(C)C.
What is the InChIKey of ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate?
The InChIKey is YBCSVZRVTGRQFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O5/c1-6-20-13(18)9-17-12(22-10-15(3,4)5)8-11(16-17)14(19)21-7-2/h8H,6-7,9-10H2,1-5H3.
What are the key properties of ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate?
ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate has a molecular weight of 312.37 g/mol, XLogP of 2.05, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(2,2-dimethylpropoxy)-1-(2-ethoxy-2-oxoethyl)pyrazole-3-carboxylate is sourced from PubChem (CID 21062968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).