About 6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol
6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol (PubChem CID 21063090) has the molecular formula C24H22O
and a molecular weight of 326.44 g/mol. Its IUPAC name is 6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol.
Molecular Properties
| Compound Name | 6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol |
| PubChem CID | 21063090 |
| Molecular Formula | C24H22O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol |
| SMILES | Cc1c2ccc(-c3c(C)c4cccccc-4c3C)ccc-2c(C)c1O |
| InChI | InChI=1S/C24H22O/c1-14-19-8-6-5-7-9-20(19)15(2)23(14)18-10-12-21-16(3)24(25)17(4)22(21)13-11-18/h5-13,25H,1-4H3 |
| InChIKey | UDSWYXZQQTXTMT-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol?
The IUPAC name of 6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol (CID 21063090) is 6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol.
What is the SMILES notation for 6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol?
The canonical SMILES for 6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol is Cc1c2ccc(-c3c(C)c4cccccc-4c3C)ccc-2c(C)c1O.
What is the InChIKey of 6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol?
The InChIKey is UDSWYXZQQTXTMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O/c1-14-19-8-6-5-7-9-20(19)15(2)23(14)18-10-12-21-16(3)24(25)17(4)22(21)13-11-18/h5-13,25H,1-4H3.
What are the key properties of 6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol?
6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol has a molecular weight of 326.44 g/mol, XLogP of 6.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-dimethylazulen-2-yl)-1,3-dimethylazulen-2-ol is sourced from PubChem (CID 21063090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).