About (6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate
(6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate (PubChem CID 21063111) has the molecular formula C13H13IO3S
and a molecular weight of 376.22 g/mol. Its IUPAC name is (6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate.
Molecular Properties
| Compound Name | (6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate |
| PubChem CID | 21063111 |
| Molecular Formula | C13H13IO3S |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | (6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate |
| SMILES | Cc1c2ccc(I)ccc-2c(C)c1OS(C)(=O)=O |
| InChI | InChI=1S/C13H13IO3S/c1-8-11-6-4-10(14)5-7-12(11)9(2)13(8)17-18(3,15)16/h4-7H,1-3H3 |
| InChIKey | BIIUCDIHCDWRLD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate?
The IUPAC name of (6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate (CID 21063111) is (6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate.
What is the SMILES notation for (6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate?
The canonical SMILES for (6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate is Cc1c2ccc(I)ccc-2c(C)c1OS(C)(=O)=O.
What is the InChIKey of (6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate?
The InChIKey is BIIUCDIHCDWRLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13IO3S/c1-8-11-6-4-10(14)5-7-12(11)9(2)13(8)17-18(3,15)16/h4-7H,1-3H3.
What are the key properties of (6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate?
(6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate has a molecular weight of 376.22 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-iodo-1,3-dimethylazulen-2-yl) methanesulfonate is sourced from PubChem (CID 21063111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).