C23H30O4 — CID 21063320
(2-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl) 4-(2-ethylpentyl)benzoate (PubChem CID 21063320) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (2-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl) 4-(2-ethylpentyl)benzoate.
| Compound Name | (2-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl) 4-(2-ethylpentyl)benzoate |
|---|---|
| PubChem CID | 21063320 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (2-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl) 4-(2-ethylpentyl)benzoate |
| SMILES | CCCC(CC)Cc1ccc(C(=O)OC2CCC3C=CC(=O)OC3C2)cc1 |
| InChI | InChI=1S/C23H30O4/c1-3-5-16(4-2)14-17-6-8-19(9-7-17)23(25)26-20-12-10-18-11-13-22(24)27-21(18)15-20/h6-9,11,13,16,18,20-21H,3-5,10,12,14-15H2,1-2H3 |
| InChIKey | FLPCLXYWWIYEGC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |