About iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole
iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole (PubChem CID 21063370) has the molecular formula C18H15F3IrN-
and a molecular weight of 494.54 g/mol. Its IUPAC name is iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole.
Molecular Properties
| Compound Name | iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole |
| PubChem CID | 21063370 |
| Molecular Formula | C18H15F3IrN- |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole |
| SMILES | [CH2-]c1cc(C(F)(F)F)ccc1C1=Nc2ccccc2C1(C)C.[Ir] |
| InChI | InChI=1S/C18H15F3N.Ir/c1-11-10-12(18(19,20)21)8-9-13(11)16-17(2,3)14-6-4-5-7-15(14)22-16;/h4-10H,1H2,2-3H3;/q-1; |
| InChIKey | VGEODFNCNTXNCP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole?
The IUPAC name of iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole (CID 21063370) is iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole.
What is the SMILES notation for iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole?
The canonical SMILES for iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole is [CH2-]c1cc(C(F)(F)F)ccc1C1=Nc2ccccc2C1(C)C.[Ir].
What is the InChIKey of iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole?
The InChIKey is VGEODFNCNTXNCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F3N.Ir/c1-11-10-12(18(19,20)21)8-9-13(11)16-17(2,3)14-6-4-5-7-15(14)22-16;/h4-10H,1H2,2-3H3;/q-1;.
What are the key properties of iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole?
iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole has a molecular weight of 494.54 g/mol, XLogP of 5.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;2-[2-methanidyl-4-(trifluoromethyl)phenyl]-3,3-dimethylindole is sourced from PubChem (CID 21063370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).