About N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine
N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine (PubChem CID 21063466) has the molecular formula C15H22N4S
and a molecular weight of 290.44 g/mol. Its IUPAC name is N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine |
| PubChem CID | 21063466 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine |
| SMILES | [H]/N=N/c1ccc2nc(N(CCCC)CCCC)sc2c1 |
| InChI | InChI=1S/C15H22N4S/c1-3-5-9-19(10-6-4-2)15-17-13-8-7-12(18-16)11-14(13)20-15/h7-8,11,16H,3-6,9-10H2,1-2H3/b18-16+ |
| InChIKey | YROORQSFLBQDEZ-FBMGVBCBSA-N |
| XLogP | 5.37 |
| TPSA | 52.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine?
The IUPAC name of N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine (CID 21063466) is N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine.
What is the SMILES notation for N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine?
The canonical SMILES for N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine is [H]/N=N/c1ccc2nc(N(CCCC)CCCC)sc2c1.
What is the InChIKey of N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine?
The InChIKey is YROORQSFLBQDEZ-FBMGVBCBSA-N. The full InChI is InChI=1S/C15H22N4S/c1-3-5-9-19(10-6-4-2)15-17-13-8-7-12(18-16)11-14(13)20-15/h7-8,11,16H,3-6,9-10H2,1-2H3/b18-16+.
What are the key properties of N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine?
N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine has a molecular weight of 290.44 g/mol, XLogP of 5.37, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-6-diazenyl-1,3-benzothiazol-2-amine is sourced from PubChem (CID 21063466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).